Skip to content
🎉 DeepSeek-R1 🥳
I'm doing sentiment analysis of tweets related to recent acquisition of Twitter by Elon Musk. I have a corpus of 10 000 tweets and I'd like to use machine learning methods using models like SVM and Linear Regression. My question is, when I want to train the models, do I have to manually tag big portion of those 10 000 collected tweets with either positive or negative class to train the model correctly or can I use some other dataset of tweets not relating to this topic that's already tagged to train the model for sentiment analysis? Thank you for your answers!

💡Okay, so I'm trying to figure out how to approach sentiment analysis on tweets about Elon Musk's acquisition of Twitter. I have 10,000 tweets, and I want to use machine learning models like SVM and Linear Regression. The big question is whether I need to manually tag a large portion of these tweets as positive or negative to train the model, or if I can use an existing dataset that's already tagged but not related to this specific topic.First, I know that machine learning models, especially supervised ones like SVM and Linear Regression, require labeled data to learn from. So, in theory, I should have some data that's already tagged with sentiment labels. But I'm not sure if I can just use any existing dataset or if I need to tag my own.I remember reading that using a pre-trained model on a different dataset can sometimes work, especially if the new data is similar in some way. Maybe if the other dataset is about social media or has similar language, it could help. But I'm not sure how much that would affect the accuracy. It might not capture the nuances specific to the Twitter acquisition context.On the other hand, manually tagging 10,000 tweets sounds really time-consuming. I wonder if there's a way to tag just a portion of them and still get good results. Maybe using active learning, where the model selects the most informative examples to label next. That could reduce the amount of manual work needed.I also think about transfer learning. If I can find a model that's already been trained on a large dataset, maybe I can fine-tune it on my specific tweets. That way, I don't have to start from scratch, and I can leverage existing knowledge while still adapting to my topic.Another thought is about the quality of the data. If I use a different dataset, even if it's tagged, the language and context might be different. For example, tweets about politics might have different slang or sentiment indicators compared to tweets about business acquisitions. This could lead to the model not performing well on my specific data.I should also consider the size of the existing dataset. If it's much larger than my 10,000 tweets, maybe it's better to use that. But if it's smaller, then maybe not. I'm not sure how to balance that.Wait, what about using a combination? Maybe use a pre-trained model on a general dataset and then fine-tune it with a small portion of my own tagged data. That could be a good middle ground. It uses existing resources but still adapts to my specific context.I'm also thinking about the possibility of using unsupervised methods, but I know that for sentiment analysis, supervised is usually more accurate. So maybe that's not the best route.In summary, I think the best approach might be to use a pre-trained model if possible, but also tag a portion of my own data to fine-tune it. That way, I don't have to tag everything, but I still get a model that's adapted to my specific tweets about the Twitter acquisition.

Create a Python function that accepts two integers as arguments and returns their sum.#Increased Difficulty#Now create a Python function that takes in a list of integers. It should return an array of arrays, where each sub-array consists of three integers from the input array that add up to zero. The returned arrays should be unique. Avoid using the itertools library for this task.Please ensure:- The function should handle an array of up to 1000 elements.- The solution should not exceed O(n^2) for time complexity.- The function should also handle the condition if no such triplets are found and return appropriate message.

💡Okay, I need to create a Python function that takes a list of integers and returns an array of arrays. Each sub-array should consist of three integers from the input that add up to zero. Also, the returned arrays should be unique, and I can't use itertools. Hmm.Wait, the initial problem was to sum two integers, but the increased difficulty is about triplets adding to zero. So I should focus on the triplet problem.First, I remember that the classic 3-sum problem is about finding all unique triplets that sum to zero. The standard approach for that is O(n^2) time, which fits the requirement here. So I need to implement that.Let me think about the steps. The standard approach is to sort the array first. Sorting helps because it allows us to skip duplicates and manage the two pointers efficiently.So step one: sort the input list.Once sorted, I can iterate through each element as the first element of the triplet. For each element, I'll use two pointers to find the other two elements that, together with the current element, sum to zero.Wait, but how do I avoid duplicates? Because if there are duplicate elements, I might end up with duplicate triplets. So I need to skip over elements that are the same as the previous one.For example, if the array is [-1, -1, 0, 1], when I'm at the first -1, I process it. Then the next -1 is the same as the previous, so I skip it.So the plan is:1. Sort the array.2. Iterate through each index i from 0 to n-3.3. For each i, if nums[i] is the same as nums[i-1], skip to avoid duplicates.4. Set left pointer to i+1 and right pointer to end of array.5. While left < right: a. Calculate current sum: nums[i] + nums[left] + nums[right]. b. If sum is zero, add the triplet to the result. c. Then, move left and right to skip duplicates. d. If sum is less than zero, move left to the right. e. If sum is greater than zero, move right to the left.Wait, but how do I handle the moving of left and right after finding a valid triplet to avoid duplicates? Because there might be multiple same elements on either side.So after adding a triplet, I should increment left and decrement right, but also skip any duplicates in the process.For example, after finding a triplet, I can do:left +=1while left < right and nums[left] == nums[left-1]: left +=1Similarly for right.This way, I skip over any duplicates immediately after the found triplet.Let me outline the steps:- Sort the array.- Initialize an empty result list.- Loop over i from 0 to len(nums)-3: - If i>0 and nums[i] == nums[i-1], skip. - Set left = i+1, right = len(nums)-1. - While left < right: - current_sum = nums[i] + nums[left] + nums[right] - if current_sum == 0: - add [nums[i], nums[left], nums[right]] to result - then, move left and right, skipping duplicates. - left +=1 - while left < right and nums[left] == nums[left-1]: left +=1 - right -=1 - while left < right and nums[right] == nums[right+1]: right -=1 - elif current_sum < 0: - left +=1 - else: - right -=1- After processing all i, check if result is empty. If yes, return appropriate message. Else, return the result.Wait, but the problem says to return an array of arrays, each with three integers. So the result is a list of triplets.But wait, what about the case where the input has less than 3 elements? Or all elements are zero? Or other edge cases.So, first, I should handle the case where the input list has less than 3 elements. In that case, return the appropriate message, like "No triplets found."So before starting, check if len(nums) <3, return message.Also, after the loop, if the result is empty, return the message.Now, let's think about the code structure.Function definition:def three_sum(nums): # code hereFirst, sort the array:nums.sort()Initialize result as empty list.Then loop:for i in range(len(nums) - 2):Wait, because i can go up to len(nums)-3, since we need i, i+1, i+2.Wait, for example, if len(nums) is 3, i can be 0 only.So in the loop, i runs from 0 to len(nums)-3, inclusive.Wait, in Python, range is exclusive on the upper end. So for len(nums) - 2, because len(nums) -3 +1 = len(nums)-2.Wait, for example, len(nums) is 5: i can be 0,1,2. Because 5-3=2, so range(3) is 0,1,2.Yes.So:for i in range(len(nums) - 2):Then, check if i>0 and nums[i] == nums[i-1], skip.Then, set left = i+1, right = len(nums)-1.Then, while left < right:Compute sum.If sum is zero: add triplet, then skip duplicates.Else, adjust left or right.Now, code:Let me write the code step by step.def three_sum(nums): nums.sort() result = [] n = len(nums) if n <3: return "No triplets found." for i in range(n-2): if i >0 and nums[i] == nums[i-1]: continue left = i+1 right = n-1 while left < right: current_sum = nums[i] + nums[left] + nums[right] if current_sum ==0: result.append([nums[i], nums[left], nums[right]]) # skip duplicates left +=1 while left < right and nums[left] == nums[left-1]: left +=1 right -=1 while left < right and nums[right] == nums[right+1]: right -=1 elif current_sum <0: left +=1 else: right -=1 if not result: return "No triplets found." return resultWait, but what about the case where the same triplet is formed in different orders? Like, if the array is [0,0,0], then the triplet [0,0,0] is valid. But in the code, since the array is sorted, it will only be added once.Wait, in the code, for i=0, left=1, right=2: sum is 0. So it's added once. Then left is incremented, but since left < right is now 2 <2? No, so loop ends.So the code correctly adds [0,0,0] once.Another test case: nums = [-1,0,1,2,-1,-4]After sorting: [-4,-1,-1,0,1,2]The triplets are [-1,-1,2], [-1,0,1].Wait, let's see:i=0: nums[i]=-4.left=1, right=5.sum is -4 + (-1) +2 = -3 <0. So left +=1.Now left=2, right=5: sum is -4 + (-1) +2 = -3 <0. left +=1.left=3: sum is -4+0+2= -2 <0. left +=1.left=4: sum is -4+1+2= -1 <0. left +=1. Now left=5, which is not less than right (5<5 is false). So i=0 loop ends.i=1: nums[i]=-1.Check if i>0 and nums[i] == nums[i-1]. nums[1] is -1, nums[0] is -4: no, so proceed.left=2, right=5.sum is -1 + (-1) +2 =0. So add triplet [-1,-1,2]. Then, left +=1 (left=3), and check if nums[3] == nums[2] (-1 vs -1: yes). So left increments until it's 3, which is not equal to 2. Then right -=1 (right=4). Check if nums[4] == nums[5] (1 vs 2: no). So loop continues.Now, left=3, right=4.sum is -1 +0 +1=0. So add triplet [-1,0,1]. Then, left +=1 (4), right -=1 (3). Now left is not less than right, so loop ends.i=2: nums[i] =-1. Now, i>0 and nums[i] == nums[i-1] (nums[1] is -1, same as i=2). So skip.i=3: nums[i]=0.left=4, right=5.sum is 0+1+2=3>0. So right -=1.sum is 0+1+2=3>0 again? Wait, no, right is now 4. So sum is 0+1+1=2>0. So right -=1 to 3. Now left >= right, loop ends.i=4: loop ends since i can be up to n-3=3.So the result is [[-1,-1,2], [-1,0,1]], which is correct.Another test case: nums = [0,0,0,0]. The triplet is [0,0,0], and it should be added once.In the code:i=0: nums[i]=0.left=1, right=3.sum is 0+0+0=0. Add to result. Then left +=1 to 2, and check if nums[2] == nums[1] (0==0: yes). So left increments to 3. Then right -=1 to 2. Now left is 3, right is 2: loop ends.So the triplet is added once.Another case: nums = [1,2,-3,4,5]. The triplet is 1+2-3=0. So the code should find it.After sorting: [-3,1,2,4,5].i=0: nums[i]=-3.left=1, right=4.sum is -3+1+5=3>0. So right -=1 to 3.sum is -3+1+4=2>0. right -=1 to 2.sum is -3+1+2=0. So add triplet [-3,1,2]. Then left +=1 to 2, right -=1 to 1. Now left >= right, loop ends.So the result is correct.What about when there are no triplets? Like nums = [1,2,3]. The code returns the message.Now, what about the time complexity? The code is O(n^2), which is acceptable for n up to 1000.But wait, in the worst case, for each i, the two pointers could take O(n) time, leading to O(n^2) time overall. Which is acceptable.So the code should handle all cases correctly.But wait, in the code, after adding a triplet, we skip duplicates for left and right. That's correct.Another thing: the code returns the result as a list of lists, which is what is required.So I think this code should work.

Develop a React-based web application using JSX, and utilize CSS-in-JS libraries for styling. The application should:1. Display the text "Congratulations, You've Made It!" in a stylish animated manner. 2. Include an interactive element (like a button) which when clicked, triggers a random celebratory animation or sound. 3. Implement error handling for display or audio disruptions. 4. Cater for accessibility considerations to ensure your text and interactive elements are accessible to all users. 5. Write test cases for your implementation, ensuring it behaves as expected.

💡Okay, I need to develop a React-based web application that meets several requirements. Let me break down each point and figure out how to approach them step by step.First, the application should display the text "Congratulations, You've Made It!" in a stylish animated manner. I know that using CSS animations can achieve this. Maybe I can create a fade-in effect or something similar. Since the user mentioned using CSS-in-JS libraries, I should consider using styled-components or emotion. I think styled-components is a good choice here because it's widely used and integrates well with React.Next, the app needs an interactive element, like a button, that triggers a random celebratory animation or sound when clicked. So, I'll need to create a button component. For the animations, perhaps I can have a few different CSS animations defined and randomly select one each time the button is clicked. For sounds, I'll need to handle audio playback. I'll have to make sure to load the audio files properly and handle any potential errors, like if the file doesn't load.Error handling is another requirement. I need to think about possible points of failure. For example, if the audio file doesn't load, I should display an error message. Also, if there's an issue with the animations, maybe I can fall back to a default style. I'll need to use try-catch blocks or error boundaries in React to handle these cases gracefully.Accessibility is important too. The text should be readable, so I'll choose a high-contrast color scheme. The button should be keyboard-navigable and have proper ARIA labels so screen readers can interpret it correctly. I'll make sure the animations don't cause seizures, perhaps by keeping them subtle and allowing users to disable them if needed.Testing is the last point. I'll need to write test cases using a testing library like React Testing Library. I'll test if the component renders correctly, if the button click triggers the animations and sounds, and if error states are handled properly. I'll also check for accessibility using tools like axe or pa11y.Putting it all together, I'll structure the React component with the necessary states and effects. I'll use styled-components for styling and animations. For the audio, I'll create a function that loads and plays the sound, handling any errors. The button will have an onClick handler that triggers both the animation and sound functions. I'll also include ARIA attributes for accessibility.I should also consider performance. Loading multiple audio files might be heavy, so I'll make sure to handle them efficiently. Maybe preloading them or using a single audio element and changing the src when needed.Finally, I'll write the test cases to ensure everything works as expected. I'll test the initial render, the button click functionality, error handling, and accessibility features. This way, I can be confident that the application meets all the requirements and is robust.

Develop a Python script to validate an email address based on specific criteria.Email criteria: should contain at least one period, one '@' symbol, and no special characters except underscore, period, and hyphen.

💡Okay, I need to develop a Python script to validate an email address based on specific criteria. Let me think about what the criteria are. The email should have at least one period, one '@' symbol, and no special characters except underscore, period, and hyphen. First, I should outline the steps. The script will take an email input from the user. Then, it will check each condition one by one. Let me break down the conditions. The email must contain exactly one '@' symbol. So, I can split the email into two parts using the '@' as a delimiter. If the resulting list doesn't have exactly two parts, it's invalid.Next, there must be at least one period in the entire email. I'll check if the count of periods is at least one. But wait, the period could be in the local part or the domain part. So, I need to make sure that overall, there's at least one.Then, the email can only contain certain special characters: underscore, period, and hyphen. All other characters are not allowed. So, I need to check each character in the email to ensure it's either alphanumeric or one of those three special characters.I should also consider the structure of the email. The local part (before '@') and the domain part (after '@') each have their own rules. For example, the local part can start with a letter or number, followed by letters, numbers, underscores, periods, or hyphens. The domain part should have at least one period, and the parts before and after the period should be valid (like 'com', 'co.uk', etc.).Wait, maybe using regular expressions would be more efficient. A regex can encapsulate all these conditions in a single pattern. Let me think about the regex structure.The local part should start with a word character (letter, number, or underscore), followed by any combination of word characters, periods, or hyphens. The domain part should have at least one period, with each segment starting and ending with a word character and possibly containing hyphens in between.Putting it all together, the regex pattern would be something like:^[a-zA-Z0-9]+[w.-]*@([a-zA-Z0-9-]+.)+[a-zA-Z0-9-]+This pattern ensures that the email has the correct structure, including the required '@' and periods, and only allows the specified special characters.So, the script will use re.match to check if the email matches this pattern. If it does, the email is valid; otherwise, it's invalid.I should also handle cases where the email is empty or has incorrect lengths. But the regex should cover that as well, since it enforces minimum lengths for both parts.Testing the script with various examples would be important. For instance, 'test@example.com' should be valid, while 'test@.com' or 'test@ex@ample.com' should be invalid.I think that covers the main points. Now, I'll structure the script: import re, get user input, define the regex pattern, use re.match, and print the result.

Given three numbers a, b, and c, write a function to swap their values in a circular pattern. That means the value of a goes to b, the value of b goes to c and the value of c goes to a.a = 5, b = 8, c = 12

💡Okay, so I need to write a function that swaps three numbers a, b, and c in a circular pattern. That means a goes to b, b goes to c, and c goes to a. Hmm, let me think about how to approach this.First, I should understand what a circular swap means. So, if a is 5, b is 8, and c is 12, after the swap, a should be 12, b should be 5, and c should be 8. Right? Let me check that. So, a was 5, it goes to b, so b becomes 5. Then b was 8, it goes to c, so c becomes 8. And c was 12, it goes to a, so a becomes 12. Yep, that makes sense.Now, how do I implement this in a function? I can't just assign them directly because that would overwrite the values before they're used. For example, if I do a = c, then b = a, but since a was just changed, it won't get the original value. So I need a way to hold onto the original values before they change.Maybe I can use temporary variables. Let me think. I can store the original a, b, and c in temporary variables. Wait, but since it's a circular swap, I can do it without using three temps. Let me see.Alternatively, I can assign a to b, but then I need to make sure that the original b is saved before it's overwritten. So perhaps:temp = aa = cc = bb = tempWait, does that work? Let me test with the numbers. Original a=5, b=8, c=12.temp = 5a = 12 (from c)c = 8 (from b)b = 5 (from temp)So now a=12, b=5, c=8. That's correct. So yes, this approach works.Alternatively, another way without using a temp variable. Maybe using the fact that in Python, we can assign multiple variables at once. Like:a, b, c = c, a, bWait, let me test that. If a=5, b=8, c=12.After the swap, a should be 12, b should be 5, c should be 8.So in the assignment, a becomes c (12), b becomes a (5), and c becomes b (8). Yes, that works too. So this is a more concise way without needing a temp variable.So the function can be written as:def swap_circular(a, b, c): a, b, c = c, a, b return a, b, cWait, but in Python, when you pass variables to a function, they are passed by assignment. So if I modify a, b, c inside the function, the original variables outside won't change unless I return them and reassign. So the function should return the new values, and the caller can assign them back.So the function would take a, b, c as parameters, perform the swap, and return the new a, b, c.Let me test this with the sample values. a=5, b=8, c=12.After swap, a=12, b=5, c=8. So the function returns (12,5,8). That's correct.Alternatively, if I wanted to modify the variables in place, but in Python, integers are immutable, so the function can't change the original variables. So the function must return the new values, and the caller must assign them.So the function is correct as written.Another way to think about it is using tuple unpacking. The right-hand side evaluates all the expressions first, then assigns them to the left-hand side variables. So c is 12, a is 5, b is 8. So a becomes 12, b becomes 5, c becomes 8. Yep, that's correct.I think this approach is efficient and clean. It doesn't require any temporary variables and is easy to read.So the final function is as above.

In a series of complex and sequential programming tasks, Larry finds himself engaged. Initially, the percentage of tasks he has successfully completed is equivalent to 3/4 of the remaining tasks. Then he manages to complete another set of tasks, each of which can be divided into 2 subtasks; the adequate completion of these subtasks is strictly monitored. Due to his hard work, Larry is in a position where the number of tasks he has completed is equal to 7/8 of those that need further work. Moreover, if Larry unexpectedly takes leave of absence for a day, 25% of remaining tasks that are of highest priority, gets equally divided among other programmers. The total number of tasks distributed among each programmer are as per the Fibonacci sequence of 5 (i.e. 5,8,13....).Based on these multilayered facts, can you infer the total number of tasks initially assigned?

💡Okay, so I have this problem about Larry and his tasks. It's a bit complex, but I'll try to break it down step by step. Let me read it again and see what information I can extract.Initially, Larry has some tasks assigned. The percentage of tasks he has completed is equivalent to 3/4 of the remaining tasks. Hmm, okay. So if I let the total number of tasks be T, then the number he's completed is 3/4 of the remaining tasks. Let me write that down.Let’s denote:- Total tasks = T- Completed tasks = C- Remaining tasks = RFrom the first statement: C = (3/4) * R.But since C + R = T, we can substitute R with T - C. So,C = (3/4)(T - C)Let me solve this equation for C.Multiply both sides by 4 to eliminate the denominator:4C = 3(T - C)Expand the right side:4C = 3T - 3CBring all terms to one side:4C + 3C = 3T7C = 3TSo, C = (3/7)T.That means Larry has completed 3/7 of the total tasks initially. Therefore, the remaining tasks R = T - C = T - (3/7)T = (4/7)T.Alright, so after the initial completion, he has 4/7 of the tasks remaining.Next, Larry completes another set of tasks. Each of these tasks can be divided into 2 subtasks, and the completion of these subtasks is strictly monitored. Hmm, not entirely sure what that means, but maybe it just means each task is split into two, so completing a task means completing both subtasks.But then it says, due to his hard work, the number of tasks he has completed is equal to 7/8 of those that need further work. So, after completing this additional set, the completed tasks are 7/8 of the remaining tasks.Let me denote the number of tasks he completes in this second phase as C2. So, the total completed tasks after this phase would be C + C2, and the remaining tasks would be R - C2.According to the problem, after this second phase:C + C2 = (7/8)(R - C2)Let me plug in the values we have from before.We know that C = (3/7)T and R = (4/7)T.So,(3/7)T + C2 = (7/8)( (4/7)T - C2 )Let me solve this equation for C2.First, expand the right side:(3/7)T + C2 = (7/8)*(4/7)T - (7/8)C2Simplify (7/8)*(4/7)T:The 7s cancel out, so it's (4/8)T = (1/2)T.So,(3/7)T + C2 = (1/2)T - (7/8)C2Let me get all the C2 terms on one side and the T terms on the other.C2 + (7/8)C2 = (1/2)T - (3/7)TCombine the C2 terms:(1 + 7/8)C2 = (4/8 + 7/8 - 3/7)T? Wait, no, let me do it step by step.Left side: C2 + (7/8)C2 = (1 + 7/8)C2 = (15/8)C2Right side: (1/2)T - (3/7)TConvert to common denominator, which is 14.(7/14)T - (6/14)T = (1/14)TSo,(15/8)C2 = (1/14)TSolve for C2:C2 = (1/14)T * (8/15) = (8/210)T = (4/105)THmm, so C2 is (4/105)T.Therefore, the total completed tasks after the second phase are:C + C2 = (3/7)T + (4/105)TConvert to common denominator, which is 105:(45/105)T + (4/105)T = (49/105)T = (7/15)TAnd the remaining tasks after the second phase are:R - C2 = (4/7)T - (4/105)TConvert to common denominator:(60/105)T - (4/105)T = (56/105)T = (8/15)TSo, after the second phase, Larry has completed 7/15 of the total tasks and 8/15 remain.Now, the next part says: if Larry unexpectedly takes a leave of absence for a day, 25% of the remaining tasks that are of highest priority gets equally divided among other programmers. The total number of tasks distributed among each programmer are as per the Fibonacci sequence of 5 (i.e., 5, 8, 13...).Wait, so when Larry takes a day off, 25% of the remaining tasks are redistributed. The remaining tasks at that point are 8/15 T. So 25% of that is (1/4)*(8/15 T) = (2/15)T.These tasks are equally divided among other programmers, and the number of tasks each programmer gets follows the Fibonacci sequence starting from 5, which is 5, 8, 13, 21, etc.So, the total number of tasks to be distributed is (2/15)T, and this total is equal to the sum of the Fibonacci sequence terms starting from 5.Let me denote the number of programmers as n, and the tasks each programmer gets as per the Fibonacci sequence. So, the first programmer gets 5 tasks, the second gets 8, the third gets 13, and so on.But the problem says the total number of tasks distributed among each programmer are as per the Fibonacci sequence of 5. Hmm, maybe it's that the number of tasks each programmer gets is a Fibonacci number starting from 5, and the total is the sum of these numbers.But it's a bit unclear. Let me parse the sentence again: "the total number of tasks distributed among each programmer are as per the Fibonacci sequence of 5 (i.e., 5,8,13....)."Wait, maybe it means that each programmer gets a number of tasks according to the Fibonacci sequence starting at 5. So, the first programmer gets 5, the second 8, the third 13, etc., and the total distributed is the sum of these.But the total tasks to distribute are (2/15)T. So, the sum of the Fibonacci sequence starting from 5 for n terms is equal to (2/15)T.But we don't know how many programmers there are. Hmm, this is tricky.Alternatively, maybe the number of programmers is such that each gets a Fibonacci number starting from 5, and the total is (2/15)T.But without knowing how many programmers, it's hard to compute. Maybe the number of programmers is given by the Fibonacci sequence? Or perhaps it's a single programmer? But that doesn't make sense because it says "among other programmers."Wait, maybe the number of programmers is 5, 8, 13, etc., but that seems off.Wait, let me think again. The total tasks to distribute are (2/15)T, and these are distributed among other programmers such that the number of tasks each programmer gets is a Fibonacci number starting from 5.So, for example, if there are two programmers, one gets 5 and the other gets 8, total is 13. If there are three programmers, 5, 8, 13, total is 26, etc.So, the total distributed tasks must be equal to the sum of the first n Fibonacci numbers starting from 5.So, let me denote S(n) as the sum of the first n Fibonacci numbers starting from 5.So, S(n) = 5 + 8 + 13 + ... + F(n+4), since the Fibonacci sequence starting from 5 is the 5th, 6th, etc., terms.But actually, the Fibonacci sequence is usually defined as F(1)=1, F(2)=1, F(3)=2, F(4)=3, F(5)=5, F(6)=8, F(7)=13, etc.So, starting from 5, which is F(5), the sequence is F(5), F(6), F(7), etc.So, S(n) = sum_{k=5}^{n+4} F(k)But actually, the sum of the first n Fibonacci numbers starting from F(1) is F(n+2) - 1. But here we are starting from F(5).So, the sum S(n) starting from F(5) for n terms is equal to sum_{k=1}^{n+4} F(k) - sum_{k=1}^{4} F(k)Which is [F(n+6) - 1] - [F(6) - 1] = F(n+6) - F(6)Since F(6) is 8.So, S(n) = F(n+6) - 8Therefore, the total tasks distributed is S(n) = F(n+6) - 8And this must equal (2/15)T.So,F(n+6) - 8 = (2/15)TBut we don't know n, the number of programmers. Hmm.But perhaps n is such that F(n+6) is just a bit larger than 8, so that (2/15)T is a reasonable number.Wait, let's see. Let's try small n.If n=1: S(1)=5. So, 5 = (2/15)T => T= (5*15)/2=37.5. Not integer.n=2: S(2)=5+8=13. So, 13=(2/15)T => T=(13*15)/2=97.5. Not integer.n=3: S(3)=5+8+13=26. So, 26=(2/15)T => T=(26*15)/2=195. Hmm, integer.n=4: S(4)=5+8+13+21=47. 47=(2/15)T => T=(47*15)/2=352.5. Not integer.n=5: S(5)=5+8+13+21+34=81. 81=(2/15)T => T=(81*15)/2=607.5. Not integer.n=6: S(6)=5+8+13+21+34+55=136. 136=(2/15)T => T=(136*15)/2=1020. Integer.So, possible Ts are 195, 1020, etc.But let's check if T=195 makes sense.Let me go back and see if T=195 satisfies all conditions.First, initial completion: C = (3/7)*195 ≈ 84.857. Not integer. Hmm, that's a problem because tasks should be whole numbers.Wait, so T must be such that (3/7)T and (4/7)T are integers. So, T must be a multiple of 7.Similarly, after that, C2 = (4/105)T. So, T must be a multiple of 105 to make C2 integer.Wait, 105 is 7*15, so T must be a multiple of 105.Looking back at possible Ts from the distribution:T=195: 195 is not a multiple of 105. 105*1=105, 105*2=210. 195 is between them, so not a multiple.T=1020: 1020 divided by 105 is 9.714... Not integer. Wait, 105*9=945, 105*10=1050. So, 1020 isn't a multiple of 105 either.Hmm, so maybe my approach is wrong.Wait, perhaps the number of tasks distributed is per programmer, not the sum. The problem says: "the total number of tasks distributed among each programmer are as per the Fibonacci sequence of 5 (i.e., 5,8,13....)."Wait, maybe it means that each programmer gets a Fibonacci number starting from 5, and the total is the sum. But if the total is (2/15)T, which must be equal to the sum of Fibonacci numbers starting from 5 for n terms.But as we saw, T must be a multiple of 105, but the Ts we got from the distribution (195, 1020) aren't multiples of 105. So, perhaps I need to find a T that is a multiple of 105 and also (2/15)T is a sum of Fibonacci numbers starting from 5.Let me see. Let’s denote T = 105k, where k is an integer.Then, (2/15)T = (2/15)*105k = 14k.So, the total tasks to distribute is 14k, which must be equal to the sum of Fibonacci numbers starting from 5 for some n terms.So, 14k = S(n) = F(n+6) - 8So, F(n+6) = 14k + 8We need F(n+6) to be a Fibonacci number equal to 14k +8.Looking at Fibonacci numbers:F(5)=5, F(6)=8, F(7)=13, F(8)=21, F(9)=34, F(10)=55, F(11)=89, F(12)=144, F(13)=233, F(14)=377, F(15)=610, etc.So, 14k +8 must be one of these.Let me see:For k=1: 14*1 +8=22. Not a Fibonacci number.k=2: 28+8=36. Not Fibonacci.k=3:42+8=50. Not Fibonacci.k=4:56+8=64. Not Fibonacci.k=5:70+8=78. Not Fibonacci.k=6:84+8=92. Not Fibonacci.k=7:98+8=106. Not Fibonacci.k=8:112+8=120. Not Fibonacci.k=9:126+8=134. Not Fibonacci.k=10:140+8=148. Not Fibonacci.k=11:154+8=162. Not Fibonacci.k=12:168+8=176. Not Fibonacci.k=13:182+8=190. Not Fibonacci.k=14:196+8=204. Not Fibonacci.k=15:210+8=218. Not Fibonacci.k=16:224+8=232. Not Fibonacci.k=17:238+8=246. Not Fibonacci.k=18:252+8=260. Not Fibonacci.k=19:266+8=274. Not Fibonacci.k=20:280+8=288. Not Fibonacci.Hmm, none of these are Fibonacci numbers. Maybe I made a mistake in the earlier steps.Wait, let's go back.We have T must be a multiple of 105, so T=105k.After the second phase, remaining tasks are (8/15)T = (8/15)*105k=56k.25% of that is 14k, which is the total tasks to distribute.These 14k tasks are distributed as per the Fibonacci sequence starting from 5.So, 14k must be equal to the sum of the first n Fibonacci numbers starting from 5.Earlier, I thought S(n) = F(n+6) -8, but maybe that's not correct.Wait, let me recast the sum.The sum of the first n Fibonacci numbers starting from F(5)=5 is:S(n) = F(5) + F(6) + ... + F(n+4)We know that the sum of the first m Fibonacci numbers is F(m+2) -1.So, sum from F(1) to F(m) = F(m+2) -1.Therefore, sum from F(5) to F(n+4) = sum from F(1) to F(n+4) - sum from F(1) to F(4)= [F(n+6) -1] - [F(6) -1] = F(n+6) - F(6)Since F(6)=8, so S(n) = F(n+6) -8.So, that part was correct.Therefore, 14k = F(n+6) -8So, F(n+6) =14k +8We need F(n+6) to be a Fibonacci number.Looking at Fibonacci numbers:F(12)=144F(13)=233F(14)=377F(15)=610F(16)=987F(17)=1597F(18)=2584F(19)=4181F(20)=6765So, let's see if 14k +8 equals any of these.For F(12)=144:14k +8=144 =>14k=136 =>k=136/14=9.714. Not integer.F(13)=233:14k +8=233 =>14k=225 =>k=225/14≈16.07. Not integer.F(14)=377:14k +8=377 =>14k=369 =>k=369/14≈26.357. Not integer.F(15)=610:14k +8=610 =>14k=602 =>k=602/14=43.Ah, k=43 is integer.So, F(n+6)=610, which is F(15). Therefore, n+6=15 =>n=9.So, n=9 programmers.Therefore, T=105k=105*43=4515.Let me verify if this works.Total tasks T=4515.Initial completion: C=(3/7)*4515=3*645=1935.Remaining R=4515-1935=2580.After completing C2=(4/105)*4515=4*43=172.Total completed after second phase:1935+172=2107.Remaining tasks:2580-172=2408.25% of remaining is 2408*0.25=602.These 602 tasks are distributed as per Fibonacci starting from 5 for 9 terms.Sum of first 9 Fibonacci numbers starting from 5:F(5)=5, F(6)=8, F(7)=13, F(8)=21, F(9)=34, F(10)=55, F(11)=89, F(12)=144, F(13)=233.Sum=5+8=13, +13=26, +21=47, +34=81, +55=136, +89=225, +144=369, +233=602.Yes, that adds up to 602. Perfect.So, T=4515.Therefore, the total number of tasks initially assigned is 4515.

Released under the MIT License.

has loaded